About cyclopenta-1,3,4-triene-1-carboximidamide
cyclopenta-1,3,4-triene-1-carboximidamide (PubChem CID 118642065) has the molecular formula C6H6N2
and a molecular weight of 106.13 g/mol. Its IUPAC name is cyclopenta-1,3,4-triene-1-carboximidamide.
Molecular Properties
| Compound Name | cyclopenta-1,3,4-triene-1-carboximidamide |
| PubChem CID | 118642065 |
| Molecular Formula | C6H6N2 |
| Molecular Weight | 106.13 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | cyclopenta-1,3,4-triene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CC=C=C1 |
| InChI | InChI=1S/C6H6N2/c7-6(8)5-3-1-2-4-5/h1,3-4H,(H3,7,8) |
| InChIKey | WZIXSOMSIOZOOT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.13 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3,4-triene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3,4-triene-1-carboximidamide?
The IUPAC name of cyclopenta-1,3,4-triene-1-carboximidamide (CID 118642065) is cyclopenta-1,3,4-triene-1-carboximidamide.
What is the SMILES notation for cyclopenta-1,3,4-triene-1-carboximidamide?
The canonical SMILES for cyclopenta-1,3,4-triene-1-carboximidamide is [H]/N=C(\N)C1=CC=C=C1.
What is the InChIKey of cyclopenta-1,3,4-triene-1-carboximidamide?
The InChIKey is WZIXSOMSIOZOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2/c7-6(8)5-3-1-2-4-5/h1,3-4H,(H3,7,8).
What are the key properties of cyclopenta-1,3,4-triene-1-carboximidamide?
cyclopenta-1,3,4-triene-1-carboximidamide has a molecular weight of 106.13 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3,4-triene-1-carboximidamide is sourced from PubChem (CID 118642065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).