C20H24N2 — CID 118642189
2,19-diazatetracyclo[10.10.0.03,10.015,20]docosa-1(12),2,10,15(20),16,18-hexaene (PubChem CID 118642189) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2,19-diazatetracyclo[10.10.0.03,10.015,20]docosa-1(12),2,10,15(20),16,18-hexaene.
| Compound Name | 2,19-diazatetracyclo[10.10.0.03,10.015,20]docosa-1(12),2,10,15(20),16,18-hexaene |
|---|---|
| PubChem CID | 118642189 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2,19-diazatetracyclo[10.10.0.03,10.015,20]docosa-1(12),2,10,15(20),16,18-hexaene |
| SMILES | c1cnc2c(c1)CCc1cc3c(nc1CC2)CCCCCC3 |
| InChI | InChI=1S/C20H24N2/c1-2-4-8-19-16(6-3-1)14-17-10-9-15-7-5-13-21-18(15)11-12-20(17)22-19/h5,7,13-14H,1-4,6,8-12H2 |
| InChIKey | WUVNBHFYYSJHTH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |