C29H34N2O6 — CID 118642481
(1R,2R,3R,3aR,8bS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 118642481) has the molecular formula C29H34N2O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is (1R,2R,3R,3aR,8bS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | (1R,2R,3R,3aR,8bS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 118642481 |
| Molecular Formula | C29H34N2O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (1R,2R,3R,3aR,8bS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | COc1ccc([C@@]23Oc4cc(OCCCCN)cc(OC)c4[C@]2(O)[C@H](O)[C@H](N)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N2O6/c1-34-20-12-10-19(11-13-20)29-24(18-8-4-3-5-9-18)26(31)27(32)28(29,33)25-22(35-2)16-21(17-23(25)37-29)36-15-7-6-14-30/h3-5,8-13,16-17,24,26-27,32-33H,6-7,14-15,30-31H2,1-2H3/t24-,26-,27-,28+,29+/m1/s1 |
| InChIKey | VNICMAGUTSLKLJ-KMGUSPSJSA-N |
| XLogP | 2.78 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|