About [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol
[(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol (PubChem CID 118642643) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol.
Molecular Properties
| Compound Name | [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol |
| PubChem CID | 118642643 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol |
| SMILES | N[C@@]1(c2ccccc2)CO[C@@H](C2CC2)C[C@H]1CO |
| InChI | InChI=1S/C15H21NO2/c16-15(12-4-2-1-3-5-12)10-18-14(11-6-7-11)8-13(15)9-17/h1-5,11,13-14,17H,6-10,16H2/t13-,14+,15+/m0/s1 |
| InChIKey | LDBYEKSIXKSLNO-RRFJBIMHSA-N |
| XLogP | 1.65 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol?
The IUPAC name of [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol (CID 118642643) is [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol.
What is the SMILES notation for [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol?
The canonical SMILES for [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol is N[C@@]1(c2ccccc2)CO[C@@H](C2CC2)C[C@H]1CO.
What is the InChIKey of [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol?
The InChIKey is LDBYEKSIXKSLNO-RRFJBIMHSA-N. The full InChI is InChI=1S/C15H21NO2/c16-15(12-4-2-1-3-5-12)10-18-14(11-6-7-11)8-13(15)9-17/h1-5,11,13-14,17H,6-10,16H2/t13-,14+,15+/m0/s1.
What are the key properties of [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol?
[(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol has a molecular weight of 247.34 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4R,5S)-5-amino-2-cyclopropyl-5-phenyloxan-4-yl]methanol is sourced from PubChem (CID 118642643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).