C45H32F6N2O2 — CID 118642817
[4-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]propan-2-yl]-2-(1-phenyl-2-phenyliminoethenyl)phenyl]methanol (PubChem CID 118642817) has the molecular formula C45H32F6N2O2 and a molecular weight of 746.75 g/mol. Its IUPAC name is [4-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]propan-2-yl]-2-(1-phenyl-2-phenyliminoethenyl)phenyl]methanol.
| Compound Name | [4-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]propan-2-yl]-2-(1-phenyl-2-phenyliminoethenyl)phenyl]methanol |
|---|---|
| PubChem CID | 118642817 |
| Molecular Formula | C45H32F6N2O2 |
| Molecular Weight | 746.75 g/mol |
| Exact Mass | 746.24 |
| IUPAC Name | [4-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]propan-2-yl]-2-(1-phenyl-2-phenyliminoethenyl)phenyl]methanol |
| SMILES | COc1ccc(C(c2ccc(CO)c(C(=C=Nc3ccccc3)c3ccccc3)c2)(C(F)(F)F)C(F)(F)F)cc1C(=C=Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H32F6N2O2/c1-55-42-25-24-35(27-39(42)41(32-16-8-3-9-17-32)29-53-37-20-12-5-13-21-37)43(44(46,47)48,45(49,50)51)34-23-22-33(30-54)38(26-34)40(31-14-6-2-7-15-31)28-52-36-18-10-4-11-19-36/h2-27,54H,30H2,1H3 |
| InChIKey | JFOKUJFEGFZJEJ-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.75 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|