C22H42O — CID 118642850
2,3,4,5-tetratert-butyl-6-methyl-3,6-dihydro-2H-pyran (PubChem CID 118642850) has the molecular formula C22H42O and a molecular weight of 322.58 g/mol. Its IUPAC name is 2,3,4,5-tetratert-butyl-6-methyl-3,6-dihydro-2H-pyran.
| Compound Name | 2,3,4,5-tetratert-butyl-6-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118642850 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | 2,3,4,5-tetratert-butyl-6-methyl-3,6-dihydro-2H-pyran |
| SMILES | CC1OC(C(C)(C)C)C(C(C)(C)C)C(C(C)(C)C)=C1C(C)(C)C |
| InChI | InChI=1S/C22H42O/c1-14-15(19(2,3)4)16(20(5,6)7)17(21(8,9)10)18(23-14)22(11,12)13/h14,17-18H,1-13H3 |
| InChIKey | KNDOBXVGHPFVCN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|