C45H32F6N2O2 — CID 118643078
2-[5-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-N,2-diphenylethenimine (PubChem CID 118643078) has the molecular formula C45H32F6N2O2 and a molecular weight of 746.75 g/mol. Its IUPAC name is 2-[5-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-N,2-diphenylethenimine.
| Compound Name | 2-[5-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-N,2-diphenylethenimine |
|---|---|
| PubChem CID | 118643078 |
| Molecular Formula | C45H32F6N2O2 |
| Molecular Weight | 746.75 g/mol |
| Exact Mass | 746.24 |
| IUPAC Name | 2-[5-[1,1,1,3,3,3-hexafluoro-2-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-N,2-diphenylethenimine |
| SMILES | COc1ccc(C(c2ccc(OC)c(C(=C=Nc3ccccc3)c3ccccc3)c2)(C(F)(F)F)C(F)(F)F)cc1C(=C=Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H32F6N2O2/c1-54-41-25-23-33(27-37(41)39(31-15-7-3-8-16-31)29-52-35-19-11-5-12-20-35)43(44(46,47)48,45(49,50)51)34-24-26-42(55-2)38(28-34)40(32-17-9-4-10-18-32)30-53-36-21-13-6-14-22-36/h3-28H,1-2H3 |
| InChIKey | ZUIZTMRTSVDFOH-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.75 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|