About 1,5a-dihydrodibenzofuran-2,8-dione
1,5a-dihydrodibenzofuran-2,8-dione (PubChem CID 118643169) has the molecular formula C12H8O3
and a molecular weight of 200.19 g/mol. Its IUPAC name is 1,5a-dihydrodibenzofuran-2,8-dione.
Molecular Properties
| Compound Name | 1,5a-dihydrodibenzofuran-2,8-dione |
| PubChem CID | 118643169 |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 1,5a-dihydrodibenzofuran-2,8-dione |
| SMILES | O=C1C=CC2OC3=C(CC(=O)C=C3)C2=C1 |
| InChI | InChI=1S/C12H8O3/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-5,11H,6H2 |
| InChIKey | UQMFTVCBFJCOLK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5a-dihydrodibenzofuran-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5a-dihydrodibenzofuran-2,8-dione?
The IUPAC name of 1,5a-dihydrodibenzofuran-2,8-dione (CID 118643169) is 1,5a-dihydrodibenzofuran-2,8-dione.
What is the SMILES notation for 1,5a-dihydrodibenzofuran-2,8-dione?
The canonical SMILES for 1,5a-dihydrodibenzofuran-2,8-dione is O=C1C=CC2OC3=C(CC(=O)C=C3)C2=C1.
What is the InChIKey of 1,5a-dihydrodibenzofuran-2,8-dione?
The InChIKey is UQMFTVCBFJCOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O3/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-5,11H,6H2.
What are the key properties of 1,5a-dihydrodibenzofuran-2,8-dione?
1,5a-dihydrodibenzofuran-2,8-dione has a molecular weight of 200.19 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5a-dihydrodibenzofuran-2,8-dione is sourced from PubChem (CID 118643169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).