About (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea
(5-amino-1,3,3-trimethylcyclohexyl)methylthiourea (PubChem CID 118643229) has the molecular formula C11H23N3S
and a molecular weight of 229.39 g/mol. Its IUPAC name is (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea.
Molecular Properties
| Compound Name | (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea |
| PubChem CID | 118643229 |
| Molecular Formula | C11H23N3S |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea |
| SMILES | CC1(C)CC(N)CC(C)(CNC(N)=S)C1 |
| InChI | InChI=1S/C11H23N3S/c1-10(2)4-8(12)5-11(3,6-10)7-14-9(13)15/h8H,4-7,12H2,1-3H3,(H3,13,14,15) |
| InChIKey | JHYWMEFBXOBOQO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea?
The IUPAC name of (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea (CID 118643229) is (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea.
What is the SMILES notation for (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea?
The canonical SMILES for (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea is CC1(C)CC(N)CC(C)(CNC(N)=S)C1.
What is the InChIKey of (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea?
The InChIKey is JHYWMEFBXOBOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3S/c1-10(2)4-8(12)5-11(3,6-10)7-14-9(13)15/h8H,4-7,12H2,1-3H3,(H3,13,14,15).
What are the key properties of (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea?
(5-amino-1,3,3-trimethylcyclohexyl)methylthiourea has a molecular weight of 229.39 g/mol, XLogP of 1.36, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-1,3,3-trimethylcyclohexyl)methylthiourea is sourced from PubChem (CID 118643229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).