C13H16ClN5O — CID 118643577
(1S,3R,4R)-3-[(2,3-diamino-5-chloro-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 118643577) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is (1S,3R,4R)-3-[(2,3-diamino-5-chloro-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,3R,4R)-3-[(2,3-diamino-5-chloro-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 118643577 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (1S,3R,4R)-3-[(2,3-diamino-5-chloro-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)C1[C@@H]2C=C[C@@H](C2)[C@H]1Nc1c(Cl)cnc(N)c1N |
| InChI | InChI=1S/C13H16ClN5O/c14-7-4-18-12(16)9(15)11(7)19-10-6-2-1-5(3-6)8(10)13(17)20/h1-2,4-6,8,10H,3,15H2,(H2,17,20)(H3,16,18,19)/t5-,6+,8?,10-/m1/s1 |
| InChIKey | AWOJUYCXYHZCAS-RTBIVUEKSA-N |
| XLogP | 0.99 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|