C14H13F3N2O — CID 118643908
1-(3,3,3-trifluoropropyl)-1,2,3,6-tetrahydropyrrolo[3,2-f]quinolin-7-one (PubChem CID 118643908) has the molecular formula C14H13F3N2O and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropyl)-1,2,3,6-tetrahydropyrrolo[3,2-f]quinolin-7-one.
| Compound Name | 1-(3,3,3-trifluoropropyl)-1,2,3,6-tetrahydropyrrolo[3,2-f]quinolin-7-one |
|---|---|
| PubChem CID | 118643908 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(3,3,3-trifluoropropyl)-1,2,3,6-tetrahydropyrrolo[3,2-f]quinolin-7-one |
| SMILES | O=c1ccc2c3c(ccc2[nH]1)NCC3CCC(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O/c15-14(16,17)6-5-8-7-18-11-3-2-10-9(13(8)11)1-4-12(20)19-10/h1-4,8,18H,5-7H2,(H,19,20) |
| InChIKey | RDVNHDDFAPVBAV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |