C10H17O3P — CID 118644130
4,4-dimethylhex-1-en-5-yn-3-yloxy(ethyl)phosphinic acid (PubChem CID 118644130) has the molecular formula C10H17O3P and a molecular weight of 216.22 g/mol. Its IUPAC name is 4,4-dimethylhex-1-en-5-yn-3-yloxy(ethyl)phosphinic acid.
| Compound Name | 4,4-dimethylhex-1-en-5-yn-3-yloxy(ethyl)phosphinic acid |
|---|---|
| PubChem CID | 118644130 |
| Molecular Formula | C10H17O3P |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4,4-dimethylhex-1-en-5-yn-3-yloxy(ethyl)phosphinic acid |
| SMILES | C#CC(C)(C)C(C=C)OP(=O)(O)CC |
| InChI | InChI=1S/C10H17O3P/c1-6-9(10(4,5)7-2)13-14(11,12)8-3/h2,6,9H,1,8H2,3-5H3,(H,11,12) |
| InChIKey | RMQYAZXZPWOVGZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|