C22H29N7O — CID 118644332
N-[4-[(1R,3S,5S)-3-hydrazinyl-5-methylcyclohexyl]-3-pyridinyl]-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide (PubChem CID 118644332) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[4-[(1R,3S,5S)-3-hydrazinyl-5-methylcyclohexyl]-3-pyridinyl]-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide.
| Compound Name | N-[4-[(1R,3S,5S)-3-hydrazinyl-5-methylcyclohexyl]-3-pyridinyl]-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118644332 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-[4-[(1R,3S,5S)-3-hydrazinyl-5-methylcyclohexyl]-3-pyridinyl]-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide |
| SMILES | CC(C)c1cnn2ccc(C(=O)Nc3cnccc3[C@@H]3C[C@H](C)C[C@H](NN)C3)nc12 |
| InChI | InChI=1S/C22H29N7O/c1-13(2)18-11-25-29-7-5-19(26-21(18)29)22(30)27-20-12-24-6-4-17(20)15-8-14(3)9-16(10-15)28-23/h4-7,11-16,28H,8-10,23H2,1-3H3,(H,27,30)/t14-,15+,16-/m0/s1 |
| InChIKey | KJVAVVWMFDTMDP-XHSDSOJGSA-N |
| XLogP | 3.24 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|