C28H29N5O3 — CID 118644407
N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-3-pyridinyl]-2-[(1R,2R)-2-phenylcyclopropyl]furo[2,3-b]pyridine-6-carboxamide (PubChem CID 118644407) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-3-pyridinyl]-2-[(1R,2R)-2-phenylcyclopropyl]furo[2,3-b]pyridine-6-carboxamide.
| Compound Name | N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-3-pyridinyl]-2-[(1R,2R)-2-phenylcyclopropyl]furo[2,3-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 118644407 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-3-pyridinyl]-2-[(1R,2R)-2-phenylcyclopropyl]furo[2,3-b]pyridine-6-carboxamide |
| SMILES | C[C@H]1CN(c2ccncc2NC(=O)c2ccc3cc([C@@H]4C[C@H]4c4ccccc4)oc3n2)C[C@@H](N)[C@@H]1O |
| InChI | InChI=1S/C28H29N5O3/c1-16-14-33(15-21(29)26(16)34)24-9-10-30-13-23(24)31-27(35)22-8-7-18-11-25(36-28(18)32-22)20-12-19(20)17-5-3-2-4-6-17/h2-11,13,16,19-21,26,34H,12,14-15,29H2,1H3,(H,31,35)/t16-,19-,20+,21+,26+/m0/s1 |
| InChIKey | LESRWQUHWMOYGM-ZJVGNUQYSA-N |
| XLogP | 3.89 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |