C16H21F3O3 — CID 118646371
1-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-2,6,6-trimethyl-3-(trifluoromethyl)cyclohex-2-ene-1,4-diol (PubChem CID 118646371) has the molecular formula C16H21F3O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-2,6,6-trimethyl-3-(trifluoromethyl)cyclohex-2-ene-1,4-diol.
| Compound Name | 1-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-2,6,6-trimethyl-3-(trifluoromethyl)cyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 118646371 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-2,6,6-trimethyl-3-(trifluoromethyl)cyclohex-2-ene-1,4-diol |
| SMILES | CC1=C(C(F)(F)F)C(O)CC(C)(C)C1(O)C#C/C(C)=C\CO |
| InChI | InChI=1S/C16H21F3O3/c1-10(6-8-20)5-7-15(22)11(2)13(16(17,18)19)12(21)9-14(15,3)4/h6,12,20-22H,8-9H2,1-4H3/b10-6- |
| InChIKey | NNZJRJPICSTMIE-POHAHGRESA-N |
| XLogP | 2.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|