C22H24F2O4 — CID 118646588
(2Z,4E)-5-[(1S)-3-[(3,4-difluorophenyl)methyl]-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 118646588) has the molecular formula C22H24F2O4 and a molecular weight of 390.43 g/mol. Its IUPAC name is (2Z,4E)-5-[(1S)-3-[(3,4-difluorophenyl)methyl]-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1S)-3-[(3,4-difluorophenyl)methyl]-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 118646588 |
| Molecular Formula | C22H24F2O4 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (2Z,4E)-5-[(1S)-3-[(3,4-difluorophenyl)methyl]-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC1=C(Cc2ccc(F)c(F)c2)C(=O)CC(C)(C)[C@@]1(O)/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C22H24F2O4/c1-13(9-20(26)27)7-8-22(28)14(2)16(19(25)12-21(22,3)4)10-15-5-6-17(23)18(24)11-15/h5-9,11,28H,10,12H2,1-4H3,(H,26,27)/b8-7+,13-9-/t22-/m1/s1 |
| InChIKey | NPEOWDKTVWZYBI-UDCIZSLQSA-N |
| XLogP | 4.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|