C24H24F2N4O5 — CID 118647065
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-propan-2-yloxy-2-pyridinyl)acetamide (PubChem CID 118647065) has the molecular formula C24H24F2N4O5 and a molecular weight of 486.48 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-propan-2-yloxy-2-pyridinyl)acetamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-propan-2-yloxy-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 118647065 |
| Molecular Formula | C24H24F2N4O5 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-(5-propan-2-yloxy-2-pyridinyl)acetamide |
| SMILES | CC(C)Oc1ccc(C(F)(F)C(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nc1 |
| InChI | InChI=1S/C24H24F2N4O5/c1-13(2)35-16-4-7-19(27-11-16)24(25,26)23(34)28-10-14-3-5-17-15(9-14)12-30(22(17)33)18-6-8-20(31)29-21(18)32/h3-5,7,9,11,13,18H,6,8,10,12H2,1-2H3,(H,28,34)(H,29,31,32) |
| InChIKey | PRTMHZHJOHIYDF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|