About 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile
6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 118648130) has the molecular formula C18H16N6O
and a molecular weight of 332.37 g/mol. Its IUPAC name is 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| PubChem CID | 118648130 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | Cc1nn(C)c2c1C(c1ccc(-n3ccnc3)cc1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C18H16N6O/c1-11-15-16(14(9-19)17(20)25-18(15)23(2)22-11)12-3-5-13(6-4-12)24-8-7-21-10-24/h3-8,10,16H,20H2,1-2H3 |
| InChIKey | KRCBRQYKLGVCAS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile?
The IUPAC name of 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (CID 118648130) is 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
What is the SMILES notation for 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile?
The canonical SMILES for 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile is Cc1nn(C)c2c1C(c1ccc(-n3ccnc3)cc1)C(C#N)=C(N)O2.
What is the InChIKey of 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile?
The InChIKey is KRCBRQYKLGVCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O/c1-11-15-16(14(9-19)17(20)25-18(15)23(2)22-11)12-3-5-13(6-4-12)24-8-7-21-10-24/h3-8,10,16H,20H2,1-2H3.
What are the key properties of 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile?
6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile has a molecular weight of 332.37 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-(4-imidazol-1-ylphenyl)-1,3-dimethyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile is sourced from PubChem (CID 118648130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).