C32H47NO3 — CID 118648720
methyl 2-(docosa-10,12-diynoylamino)-3-phenylpropanoate (PubChem CID 118648720) has the molecular formula C32H47NO3 and a molecular weight of 493.73 g/mol. Its IUPAC name is methyl 2-(docosa-10,12-diynoylamino)-3-phenylpropanoate.
| Compound Name | methyl 2-(docosa-10,12-diynoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 118648720 |
| Molecular Formula | C32H47NO3 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.36 |
| IUPAC Name | methyl 2-(docosa-10,12-diynoylamino)-3-phenylpropanoate |
| SMILES | CCCCCCCCCC#CC#CCCCCCCCCC(=O)NC(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C32H47NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27-31(34)33-30(32(35)36-2)28-29-25-22-21-23-26-29/h21-23,25-26,30H,3-10,15-20,24,27-28H2,1-2H3,(H,33,34) |
| InChIKey | YIRKIXIAJRIXLS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|