C27H24FN5O3 — CID 118649263
N-[3-[4-amino-3-[4-(2-fluorophenoxy)phenyl]-7-oxo-6H-pyrrolo[2,3-d]pyridazin-1-yl]cyclopentyl]but-2-ynamide (PubChem CID 118649263) has the molecular formula C27H24FN5O3 and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[3-[4-amino-3-[4-(2-fluorophenoxy)phenyl]-7-oxo-6H-pyrrolo[2,3-d]pyridazin-1-yl]cyclopentyl]but-2-ynamide.
| Compound Name | N-[3-[4-amino-3-[4-(2-fluorophenoxy)phenyl]-7-oxo-6H-pyrrolo[2,3-d]pyridazin-1-yl]cyclopentyl]but-2-ynamide |
|---|---|
| PubChem CID | 118649263 |
| Molecular Formula | C27H24FN5O3 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-[3-[4-amino-3-[4-(2-fluorophenoxy)phenyl]-7-oxo-6H-pyrrolo[2,3-d]pyridazin-1-yl]cyclopentyl]but-2-ynamide |
| SMILES | CC#CC(=O)NC1CCC(n2cc(-c3ccc(Oc4ccccc4F)cc3)c3c(N)n[nH]c(=O)c32)C1 |
| InChI | InChI=1S/C27H24FN5O3/c1-2-5-23(34)30-17-10-11-18(14-17)33-15-20(24-25(33)27(35)32-31-26(24)29)16-8-12-19(13-9-16)36-22-7-4-3-6-21(22)28/h3-4,6-9,12-13,15,17-18H,10-11,14H2,1H3,(H2,29,31)(H,30,34)(H,32,35) |
| InChIKey | APCWYZNDESCVPG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|