C26H24FN5O3 — CID 118649289
4-amino-3-(2-fluoro-4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-6H-pyrrolo[2,3-d]pyridazin-7-one (PubChem CID 118649289) has the molecular formula C26H24FN5O3 and a molecular weight of 473.51 g/mol. Its IUPAC name is 4-amino-3-(2-fluoro-4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-6H-pyrrolo[2,3-d]pyridazin-7-one.
| Compound Name | 4-amino-3-(2-fluoro-4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-6H-pyrrolo[2,3-d]pyridazin-7-one |
|---|---|
| PubChem CID | 118649289 |
| Molecular Formula | C26H24FN5O3 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 4-amino-3-(2-fluoro-4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-6H-pyrrolo[2,3-d]pyridazin-7-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2cc(-c3ccc(Oc4ccccc4)cc3F)c3c(N)n[nH]c(=O)c32)C1 |
| InChI | InChI=1S/C26H24FN5O3/c1-2-22(33)31-12-6-7-16(14-31)32-15-20(23-24(32)26(34)30-29-25(23)28)19-11-10-18(13-21(19)27)35-17-8-4-3-5-9-17/h2-5,8-11,13,15-16H,1,6-7,12,14H2,(H2,28,29)(H,30,34)/t16-/m1/s1 |
| InChIKey | ZQMBJORCMASICC-MRXNPFEDSA-N |
| XLogP | 4.25 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|