C19H14F2N2O3 — CID 118649461
3-(3,5-difluoroanilino)-4-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 118649461) has the molecular formula C19H14F2N2O3 and a molecular weight of 356.33 g/mol. Its IUPAC name is 3-(3,5-difluoroanilino)-4-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3,5-difluoroanilino)-4-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 118649461 |
| Molecular Formula | C19H14F2N2O3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-(3,5-difluoroanilino)-4-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2cc(F)cc(F)c2)c(N[C@H]2c3ccccc3C[C@H]2O)c1=O |
| InChI | InChI=1S/C19H14F2N2O3/c20-10-6-11(21)8-12(7-10)22-16-17(19(26)18(16)25)23-15-13-4-2-1-3-9(13)5-14(15)24/h1-4,6-8,14-15,22-24H,5H2/t14-,15+/m1/s1 |
| InChIKey | BCBZDEPXRGUSRR-CABCVRRESA-N |
| XLogP | 2.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|