C16H30N6O5 — CID 118649948
(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(1-aminoethenylamino)-N-[(3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]pentanamide (PubChem CID 118649948) has the molecular formula C16H30N6O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(1-aminoethenylamino)-N-[(3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(1-aminoethenylamino)-N-[(3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 118649948 |
| Molecular Formula | C16H30N6O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(1-aminoethenylamino)-N-[(3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]pentanamide |
| SMILES | C=C(N)NCCC[C@H](NC(=O)[C@H](C)NC(C)=O)C(=O)NC(C(N)=O)[C@@H](C)O |
| InChI | InChI=1S/C16H30N6O5/c1-8(20-11(4)24)15(26)21-12(6-5-7-19-10(3)17)16(27)22-13(9(2)23)14(18)25/h8-9,12-13,19,23H,3,5-7,17H2,1-2,4H3,(H2,18,25)(H,20,24)(H,21,26)(H,22,27)/t8-,9+,12-,13?/m0/s1 |
| InChIKey | ZDGIPGLNYAMUIN-XYINWRBLSA-N |
| XLogP | -2.85 |
| TPSA | 188.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|