C24H29N3O7 — CID 118650459
N'-tert-butyl-N'-(3,5-dimethoxy-4-methyl-2-nitrosobenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 118650459) has the molecular formula C24H29N3O7 and a molecular weight of 471.51 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dimethoxy-4-methyl-2-nitrosobenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dimethoxy-4-methyl-2-nitrosobenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 118650459 |
| Molecular Formula | C24H29N3O7 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethoxy-4-methyl-2-nitrosobenzoyl)-5-methyl-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | COc1cc(C(=O)N(NC(=O)c2ccc3c(c2C)OCCO3)C(C)(C)C)c(N=O)c(OC)c1C |
| InChI | InChI=1S/C24H29N3O7/c1-13-15(8-9-17-20(13)34-11-10-33-17)22(28)25-27(24(3,4)5)23(29)16-12-18(31-6)14(2)21(32-7)19(16)26-30/h8-9,12H,10-11H2,1-7H3,(H,25,28) |
| InChIKey | IMCVLJUDENVQIH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|