C17H13ClN2O6S — CID 1186507
(E)-2-(4-chlorophenyl)sulfonyl-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)prop-2-enenitrile (PubChem CID 1186507) has the molecular formula C17H13ClN2O6S and a molecular weight of 408.82 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)sulfonyl-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1186507 |
| Molecular Formula | C17H13ClN2O6S |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)S(=O)(=O)c2ccc(Cl)cc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H13ClN2O6S/c1-2-26-16-9-11(8-15(17(16)21)20(22)23)7-14(10-19)27(24,25)13-5-3-12(18)4-6-13/h3-9,21H,2H2,1H3/b14-7+ |
| InChIKey | QPRLWYOYHMNXPC-VGOFMYFVSA-N |
| XLogP | 3.69 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|