C48H45N3O4 — CID 118650774
9-benzyl-3-N-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-3-N,6-N,6-N-tris(4-methoxyphenyl)carbazole-3,6-diamine (PubChem CID 118650774) has the molecular formula C48H45N3O4 and a molecular weight of 727.90 g/mol. Its IUPAC name is 9-benzyl-3-N-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-3-N,6-N,6-N-tris(4-methoxyphenyl)carbazole-3,6-diamine.
| Compound Name | 9-benzyl-3-N-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-3-N,6-N,6-N-tris(4-methoxyphenyl)carbazole-3,6-diamine |
|---|---|
| PubChem CID | 118650774 |
| Molecular Formula | C48H45N3O4 |
| Molecular Weight | 727.90 g/mol |
| Exact Mass | 727.34 |
| IUPAC Name | 9-benzyl-3-N-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-3-N,6-N,6-N-tris(4-methoxyphenyl)carbazole-3,6-diamine |
| SMILES | C/C=C\C(=C/C=C/N(c1ccc(OC)cc1)c1ccc2c(c1)c1cc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)ccc1n2Cc1ccccc1)OC |
| InChI | InChI=1S/C48H45N3O4/c1-6-11-41(52-2)14-10-31-49(36-15-23-42(53-3)24-16-36)39-21-29-47-45(32-39)46-33-40(22-30-48(46)50(47)34-35-12-8-7-9-13-35)51(37-17-25-43(54-4)26-18-37)38-19-27-44(55-5)28-20-38/h6-33H,34H2,1-5H3/b11-6-,31-10+,41-14+ |
| InChIKey | GDYZUMHHOSAJCG-DHLXKLEWSA-N |
| XLogP | 12.10 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.90 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|