C13H15ClN4 — CID 118650802
(Z)-N'-[1-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethenyl]but-2-enimidamide (PubChem CID 118650802) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is (Z)-N'-[1-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethenyl]but-2-enimidamide.
| Compound Name | (Z)-N'-[1-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethenyl]but-2-enimidamide |
|---|---|
| PubChem CID | 118650802 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (Z)-N'-[1-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)ethenyl]but-2-enimidamide |
| SMILES | C=C(/N=C(N)/C=C\C)C1=CNC2NC=C(Cl)C=C12 |
| InChI | InChI=1S/C13H15ClN4/c1-3-4-12(15)18-8(2)11-7-17-13-10(11)5-9(14)6-16-13/h3-7,13,16-17H,2H2,1H3,(H2,15,18)/b4-3- |
| InChIKey | BBTZPOACPLSZQE-ARJAWSKDSA-N |
| XLogP | 1.86 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|