C19H25F3IN5O2 — CID 118650828
tert-butyl N-[6-(cyclopentylamino)-3-iodoimidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate (PubChem CID 118650828) has the molecular formula C19H25F3IN5O2 and a molecular weight of 539.34 g/mol. Its IUPAC name is tert-butyl N-[6-(cyclopentylamino)-3-iodoimidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate.
| Compound Name | tert-butyl N-[6-(cyclopentylamino)-3-iodoimidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate |
|---|---|
| PubChem CID | 118650828 |
| Molecular Formula | C19H25F3IN5O2 |
| Molecular Weight | 539.34 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | tert-butyl N-[6-(cyclopentylamino)-3-iodoimidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC(F)(F)F)c1cc(NC2CCCC2)nn2c(I)cnc12 |
| InChI | InChI=1S/C19H25F3IN5O2/c1-18(2,3)30-17(29)27(9-8-19(20,21)22)13-10-15(25-12-6-4-5-7-12)26-28-14(23)11-24-16(13)28/h10-12H,4-9H2,1-3H3,(H,25,26) |
| InChIKey | OMUBJNIHVVNNOZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.34 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|