C19H26F3N5O2 — CID 118650833
tert-butyl N-[6-(cyclopentylamino)imidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate (PubChem CID 118650833) has the molecular formula C19H26F3N5O2 and a molecular weight of 413.44 g/mol. Its IUPAC name is tert-butyl N-[6-(cyclopentylamino)imidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate.
| Compound Name | tert-butyl N-[6-(cyclopentylamino)imidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate |
|---|---|
| PubChem CID | 118650833 |
| Molecular Formula | C19H26F3N5O2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | tert-butyl N-[6-(cyclopentylamino)imidazo[1,2-b]pyridazin-8-yl]-N-(3,3,3-trifluoropropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC(F)(F)F)c1cc(NC2CCCC2)nn2ccnc12 |
| InChI | InChI=1S/C19H26F3N5O2/c1-18(2,3)29-17(28)26(10-8-19(20,21)22)14-12-15(24-13-6-4-5-7-13)25-27-11-9-23-16(14)27/h9,11-13H,4-8,10H2,1-3H3,(H,24,25) |
| InChIKey | VCRKOUPXSMOIQU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|