C50H31N5S — CID 118651048
3-[3-dibenzothiophen-4-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-pyridin-2-ylcarbazole (PubChem CID 118651048) has the molecular formula C50H31N5S and a molecular weight of 733.90 g/mol. Its IUPAC name is 3-[3-dibenzothiophen-4-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-pyridin-2-ylcarbazole.
| Compound Name | 3-[3-dibenzothiophen-4-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 118651048 |
| Molecular Formula | C50H31N5S |
| Molecular Weight | 733.90 g/mol |
| Exact Mass | 733.23 |
| IUPAC Name | 3-[3-dibenzothiophen-4-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-pyridin-2-ylcarbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccc5c(c4)c4ccccc4n5-c4ccccn4)cc(-c4cccc5c4sc4ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C50H31N5S/c1-3-14-32(15-4-1)48-52-49(33-16-5-2-6-17-33)54-50(53-48)37-29-35(28-36(30-37)38-20-13-21-41-40-19-8-10-23-45(40)56-47(38)41)34-25-26-44-42(31-34)39-18-7-9-22-43(39)55(44)46-24-11-12-27-51-46/h1-31H |
| InChIKey | PFBGJCWBEGPPEK-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.90 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |