C12H17NO — CID 118651253
3-[(2Z,4Z)-6-iminohexa-2,4-dien-3-yl]cyclohexan-1-one (PubChem CID 118651253) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-[(2Z,4Z)-6-iminohexa-2,4-dien-3-yl]cyclohexan-1-one.
| Compound Name | 3-[(2Z,4Z)-6-iminohexa-2,4-dien-3-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 118651253 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-[(2Z,4Z)-6-iminohexa-2,4-dien-3-yl]cyclohexan-1-one |
| SMILES | [H]/N=C/C=C\C(=C/C)C1CCCC(=O)C1 |
| InChI | InChI=1S/C12H17NO/c1-2-10(6-4-8-13)11-5-3-7-12(14)9-11/h2,4,6,8,11,13H,3,5,7,9H2,1H3/b6-4-,10-2+,13-8+ |
| InChIKey | ULSPUJQTTOFZCR-MOSZGGLESA-N |
| XLogP | 2.90 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|