C20H22N2O5 — CID 118652040
N-[[(2S,3R,4S)-4-(benzamidomethyl)-3,4-dihydroxyoxolan-2-yl]methyl]benzamide (PubChem CID 118652040) has the molecular formula C20H22N2O5 and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[[(2S,3R,4S)-4-(benzamidomethyl)-3,4-dihydroxyoxolan-2-yl]methyl]benzamide.
| Compound Name | N-[[(2S,3R,4S)-4-(benzamidomethyl)-3,4-dihydroxyoxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 118652040 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[[(2S,3R,4S)-4-(benzamidomethyl)-3,4-dihydroxyoxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1OC[C@@](O)(CNC(=O)c2ccccc2)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O5/c23-17-16(11-21-18(24)14-7-3-1-4-8-14)27-13-20(17,26)12-22-19(25)15-9-5-2-6-10-15/h1-10,16-17,23,26H,11-13H2,(H,21,24)(H,22,25)/t16-,17+,20-/m0/s1 |
| InChIKey | PJWVRKFXHQXQAC-QKLQHJQFSA-N |
| XLogP | 0.34 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |