C21H23ClN4O5 — CID 118652080
N-[[(3aS,6R,6aR)-6-[[(2-chlorobenzoyl)amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide (PubChem CID 118652080) has the molecular formula C21H23ClN4O5 and a molecular weight of 446.89 g/mol. Its IUPAC name is N-[[(3aS,6R,6aR)-6-[[(2-chlorobenzoyl)amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[(3aS,6R,6aR)-6-[[(2-chlorobenzoyl)amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 118652080 |
| Molecular Formula | C21H23ClN4O5 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[[(3aS,6R,6aR)-6-[[(2-chlorobenzoyl)amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CNC(=O)c3ccccc3Cl)OC[C@]2(CNC(=O)c2ccnnc2)O1 |
| InChI | InChI=1S/C21H23ClN4O5/c1-20(2)30-17-16(10-23-19(28)14-5-3-4-6-15(14)22)29-12-21(17,31-20)11-24-18(27)13-7-8-25-26-9-13/h3-9,16-17H,10-12H2,1-2H3,(H,23,28)(H,24,27)/t16-,17-,21+/m1/s1 |
| InChIKey | FRCYNPQYKQLGFR-LZJOCLMNSA-N |
| XLogP | 1.58 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |