C22H23N5O5 — CID 118652109
N-[[(3aS,6R,6aR)-6-[[(2-cyanobenzoyl)amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide (PubChem CID 118652109) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is N-[[(3aS,6R,6aR)-6-[[(2-cyanobenzoyl)amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[(3aS,6R,6aR)-6-[[(2-cyanobenzoyl)amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 118652109 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[[(3aS,6R,6aR)-6-[[(2-cyanobenzoyl)amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CNC(=O)c3ccccc3C#N)OC[C@]2(CNC(=O)c2ccnnc2)O1 |
| InChI | InChI=1S/C22H23N5O5/c1-21(2)31-18-17(11-24-20(29)16-6-4-3-5-14(16)9-23)30-13-22(18,32-21)12-25-19(28)15-7-8-26-27-10-15/h3-8,10,17-18H,11-13H2,1-2H3,(H,24,29)(H,25,28)/t17-,18-,22+/m1/s1 |
| InChIKey | YRIXKVKWBSMMQD-HMFYCAOWSA-N |
| XLogP | 0.80 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |