C20H21IN2O5 — CID 118652154
N-[[(2R,3R,4S)-4-(benzamidomethyl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-iodobenzamide (PubChem CID 118652154) has the molecular formula C20H21IN2O5 and a molecular weight of 496.30 g/mol. Its IUPAC name is N-[[(2R,3R,4S)-4-(benzamidomethyl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-iodobenzamide.
| Compound Name | N-[[(2R,3R,4S)-4-(benzamidomethyl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 118652154 |
| Molecular Formula | C20H21IN2O5 |
| Molecular Weight | 496.30 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | N-[[(2R,3R,4S)-4-(benzamidomethyl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-iodobenzamide |
| SMILES | O=C(NC[C@]1(O)CO[C@H](CNC(=O)c2ccccc2I)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H21IN2O5/c21-15-9-5-4-8-14(15)19(26)22-10-16-17(24)20(27,12-28-16)11-23-18(25)13-6-2-1-3-7-13/h1-9,16-17,24,27H,10-12H2,(H,22,26)(H,23,25)/t16-,17-,20+/m1/s1 |
| InChIKey | UNOHZWUUITVNRK-HLIPFELVSA-N |
| XLogP | 0.94 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|