C21H24N4O5 — CID 118652177
N-[[(3aS,6R,6aR)-3a-(benzamidomethyl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]pyridazine-4-carboxamide (PubChem CID 118652177) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[[(3aS,6R,6aR)-3a-(benzamidomethyl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[(3aS,6R,6aR)-3a-(benzamidomethyl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 118652177 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[[(3aS,6R,6aR)-3a-(benzamidomethyl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]pyridazine-4-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CNC(=O)c3ccnnc3)OC[C@]2(CNC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C21H24N4O5/c1-20(2)29-17-16(11-22-19(27)15-8-9-24-25-10-15)28-13-21(17,30-20)12-23-18(26)14-6-4-3-5-7-14/h3-10,16-17H,11-13H2,1-2H3,(H,22,27)(H,23,26)/t16-,17-,21+/m1/s1 |
| InChIKey | AQSODFCWHOBXRV-LZJOCLMNSA-N |
| XLogP | 0.93 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |