C19H18N4O6 — CID 118652195
N-[[(3S,4R,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydroxyoxolan-3-yl]methyl]pyridazine-4-carboxamide (PubChem CID 118652195) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is N-[[(3S,4R,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydroxyoxolan-3-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[(3S,4R,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydroxyoxolan-3-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 118652195 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[[(3S,4R,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydroxyoxolan-3-yl]methyl]pyridazine-4-carboxamide |
| SMILES | O=C(NC[C@]1(O)CO[C@H](CN2C(=O)c3ccccc3C2=O)[C@H]1O)c1ccnnc1 |
| InChI | InChI=1S/C19H18N4O6/c24-15-14(8-23-17(26)12-3-1-2-4-13(12)18(23)27)29-10-19(15,28)9-20-16(25)11-5-6-21-22-7-11/h1-7,14-15,24,28H,8-10H2,(H,20,25)/t14-,15-,19+/m1/s1 |
| InChIKey | DJRZIPMZPWPWFS-CLCXKQKWSA-N |
| XLogP | -1.01 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|