C21H19ClN2O6 — CID 118652222
2-chloro-N-[[(2R,3R,4S)-4-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methyl]benzamide (PubChem CID 118652222) has the molecular formula C21H19ClN2O6 and a molecular weight of 430.84 g/mol. Its IUPAC name is 2-chloro-N-[[(2R,3R,4S)-4-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[(2R,3R,4S)-4-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 118652222 |
| Molecular Formula | C21H19ClN2O6 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-chloro-N-[[(2R,3R,4S)-4-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1OC[C@@](O)(CN2C(=O)c3ccccc3C2=O)[C@@H]1O)c1ccccc1Cl |
| InChI | InChI=1S/C21H19ClN2O6/c22-15-8-4-3-7-14(15)18(26)23-9-16-17(25)21(29,11-30-16)10-24-19(27)12-5-1-2-6-13(12)20(24)28/h1-8,16-17,25,29H,9-11H2,(H,23,26)/t16-,17-,21+/m1/s1 |
| InChIKey | RDJVDSWLLNSFPS-LZJOCLMNSA-N |
| XLogP | 0.86 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|