C27H29ClN2O6S2 — CID 118654080
[(1R,2S,4R)-4-[2-[5-(8-chloro-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)thiophene-2-carbonyl]anilino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118654080) has the molecular formula C27H29ClN2O6S2 and a molecular weight of 577.12 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[2-[5-(8-chloro-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)thiophene-2-carbonyl]anilino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[2-[5-(8-chloro-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)thiophene-2-carbonyl]anilino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118654080 |
| Molecular Formula | C27H29ClN2O6S2 |
| Molecular Weight | 577.12 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | [(1R,2S,4R)-4-[2-[5-(8-chloro-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)thiophene-2-carbonyl]anilino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ccccc2C(=O)c2ccc(C3OCCCc4ccc(Cl)cc43)s2)C[C@@H]1O |
| InChI | InChI=1S/C27H29ClN2O6S2/c28-18-8-7-16-4-3-11-35-27(21(16)13-18)25-10-9-24(37-25)26(32)20-5-1-2-6-22(20)30-19-12-17(23(31)14-19)15-36-38(29,33)34/h1-2,5-10,13,17,19,23,27,30-31H,3-4,11-12,14-15H2,(H2,29,33,34)/t17-,19-,23+,27?/m1/s1 |
| InChIKey | ZSWYNYYICYJWKO-UFTPTIHNSA-N |
| XLogP | 4.46 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.12 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|