C33H41N2O9+ — CID 11865462
methyl (1S,15S,17S,18R,19R,20R)-6,18-dimethoxy-17-(3,4,5-trimethoxybenzoyl)oxy-3,11,12,13,14,15,16,17,18,19,20,21-dodecahydro-1H-yohimban-13-ium-19-carboxylate (PubChem CID 11865462) has the molecular formula C33H41N2O9+ and a molecular weight of 609.70 g/mol. Its IUPAC name is methyl (1S,15S,17S,18R,19R,20R)-6,18-dimethoxy-17-(3,4,5-trimethoxybenzoyl)oxy-3,11,12,13,14,15,16,17,18,19,20,21-dodecahydro-1H-yohimban-13-ium-19-carboxylate.
| Compound Name | methyl (1S,15S,17S,18R,19R,20R)-6,18-dimethoxy-17-(3,4,5-trimethoxybenzoyl)oxy-3,11,12,13,14,15,16,17,18,19,20,21-dodecahydro-1H-yohimban-13-ium-19-carboxylate |
|---|---|
| PubChem CID | 11865462 |
| Molecular Formula | C33H41N2O9+ |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | methyl (1S,15S,17S,18R,19R,20R)-6,18-dimethoxy-17-(3,4,5-trimethoxybenzoyl)oxy-3,11,12,13,14,15,16,17,18,19,20,21-dodecahydro-1H-yohimban-13-ium-19-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C[C@H]3c4[nH]c5cc(OC)ccc5c4CC[NH+]3C[C@H]2C[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)[C@@H]1OC |
| InChI | InChI=1S/C33H40N2O9/c1-38-19-7-8-20-21-9-10-35-16-18-13-27(44-32(36)17-11-25(39-2)30(41-4)26(12-17)40-3)31(42-5)28(33(37)43-6)22(18)15-24(35)29(21)34-23(20)14-19/h7-8,11-12,14,18,22,24,27-28,31,34H,9-10,13,15-16H2,1-6H3/p+1/t18-,22-,24+,27+,28-,31+/m1/s1 |
| InChIKey | QEVHRUUCFGRFIF-CNBSJGBVSA-O |
| XLogP | 2.75 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|