About 3-pentan-3-yl-3H-pyrrole
3-pentan-3-yl-3H-pyrrole (PubChem CID 118654898) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 3-pentan-3-yl-3H-pyrrole.
Molecular Properties
| Compound Name | 3-pentan-3-yl-3H-pyrrole |
| PubChem CID | 118654898 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3-pentan-3-yl-3H-pyrrole |
| SMILES | CCC(CC)C1C=CN=C1 |
| InChI | InChI=1S/C9H15N/c1-3-8(4-2)9-5-6-10-7-9/h5-9H,3-4H2,1-2H3 |
| InChIKey | YWYRABXQMAUQBC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-pentan-3-yl-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentan-3-yl-3H-pyrrole?
The IUPAC name of 3-pentan-3-yl-3H-pyrrole (CID 118654898) is 3-pentan-3-yl-3H-pyrrole.
What is the SMILES notation for 3-pentan-3-yl-3H-pyrrole?
The canonical SMILES for 3-pentan-3-yl-3H-pyrrole is CCC(CC)C1C=CN=C1.
What is the InChIKey of 3-pentan-3-yl-3H-pyrrole?
The InChIKey is YWYRABXQMAUQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-3-8(4-2)9-5-6-10-7-9/h5-9H,3-4H2,1-2H3.
What are the key properties of 3-pentan-3-yl-3H-pyrrole?
3-pentan-3-yl-3H-pyrrole has a molecular weight of 137.23 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentan-3-yl-3H-pyrrole is sourced from PubChem (CID 118654898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).