C21H31N3O7 — CID 11865522
methyl (2R)-3-methyl-2-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexanecarbonyl]amino]butanoate (PubChem CID 11865522) has the molecular formula C21H31N3O7 and a molecular weight of 437.49 g/mol. Its IUPAC name is methyl (2R)-3-methyl-2-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexanecarbonyl]amino]butanoate.
| Compound Name | methyl (2R)-3-methyl-2-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexanecarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 11865522 |
| Molecular Formula | C21H31N3O7 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | methyl (2R)-3-methyl-2-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[(4-methylphenyl)carbamoylamino]cyclohexanecarbonyl]amino]butanoate |
| SMILES | COC(=O)[C@H](NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(C)cc2)C1)C(C)C |
| InChI | InChI=1S/C21H31N3O7/c1-11(2)16(18(27)31-4)24-19(28)21(30)9-14(17(26)15(25)10-21)23-20(29)22-13-7-5-12(3)6-8-13/h5-8,11,14-17,25-26,30H,9-10H2,1-4H3,(H,24,28)(H2,22,23,29)/t14-,15+,16+,17+,21-/m0/s1 |
| InChIKey | QSWSSISUDNIKNZ-BVKCEDBHSA-N |
| XLogP | 0.05 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |