C48H40N2O2 — CID 118655435
1,1,4,4-tetramethyl-3,6-bis[4-(N-phenylanilino)phenyl]pentalene-2,5-dione (PubChem CID 118655435) has the molecular formula C48H40N2O2 and a molecular weight of 676.86 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-3,6-bis[4-(N-phenylanilino)phenyl]pentalene-2,5-dione.
| Compound Name | 1,1,4,4-tetramethyl-3,6-bis[4-(N-phenylanilino)phenyl]pentalene-2,5-dione |
|---|---|
| PubChem CID | 118655435 |
| Molecular Formula | C48H40N2O2 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | 1,1,4,4-tetramethyl-3,6-bis[4-(N-phenylanilino)phenyl]pentalene-2,5-dione |
| SMILES | CC1(C)C(=O)C(c2ccc(N(c3ccccc3)c3ccccc3)cc2)=C2C1=C(c1ccc(N(c3ccccc3)c3ccccc3)cc1)C(=O)C2(C)C |
| InChI | InChI=1S/C48H40N2O2/c1-47(2)43-41(33-25-29-39(30-26-33)49(35-17-9-5-10-18-35)36-19-11-6-12-20-36)46(52)48(3,4)44(43)42(45(47)51)34-27-31-40(32-28-34)50(37-21-13-7-14-22-37)38-23-15-8-16-24-38/h5-32H,1-4H3 |
| InChIKey | HMIDQXMUORLDTR-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |