C50H32N2O4 — CID 118655492
1,4-bis[4-(N-phenylanilino)naphthalen-1-yl]furo[3,4-c]furan-3,6-dione (PubChem CID 118655492) has the molecular formula C50H32N2O4 and a molecular weight of 724.82 g/mol. Its IUPAC name is 1,4-bis[4-(N-phenylanilino)naphthalen-1-yl]furo[3,4-c]furan-3,6-dione.
| Compound Name | 1,4-bis[4-(N-phenylanilino)naphthalen-1-yl]furo[3,4-c]furan-3,6-dione |
|---|---|
| PubChem CID | 118655492 |
| Molecular Formula | C50H32N2O4 |
| Molecular Weight | 724.82 g/mol |
| Exact Mass | 724.24 |
| IUPAC Name | 1,4-bis[4-(N-phenylanilino)naphthalen-1-yl]furo[3,4-c]furan-3,6-dione |
| SMILES | O=C1OC(c2ccc(N(c3ccccc3)c3ccccc3)c3ccccc23)=C2C(=O)OC(c3ccc(N(c4ccccc4)c4ccccc4)c4ccccc34)=C12 |
| InChI | InChI=1S/C50H32N2O4/c53-49-45-46(48(56-49)42-30-32-44(40-28-16-14-26-38(40)42)52(35-21-9-3-10-22-35)36-23-11-4-12-24-36)50(54)55-47(45)41-29-31-43(39-27-15-13-25-37(39)41)51(33-17-5-1-6-18-33)34-19-7-2-8-20-34/h1-32H |
| InChIKey | IAZFIENKKMNNSK-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.82 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|