About 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine
6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine (PubChem CID 118656020) has the molecular formula C20H21N3
and a molecular weight of 303.41 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine.
Molecular Properties
| Compound Name | 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine |
| PubChem CID | 118656020 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine |
| SMILES | CCc1ccc(-c2cc3cc4c(cc(N)n4C)cc3n2C)cc1 |
| InChI | InChI=1S/C20H21N3/c1-4-13-5-7-14(8-6-13)17-9-15-10-19-16(11-18(15)22(17)2)12-20(21)23(19)3/h5-12H,4,21H2,1-3H3 |
| InChIKey | WWQCWWCOCXRVDX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine?
The IUPAC name of 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine (CID 118656020) is 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine.
What is the SMILES notation for 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine?
The canonical SMILES for 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine is CCc1ccc(-c2cc3cc4c(cc(N)n4C)cc3n2C)cc1.
What is the InChIKey of 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine?
The InChIKey is WWQCWWCOCXRVDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3/c1-4-13-5-7-14(8-6-13)17-9-15-10-19-16(11-18(15)22(17)2)12-20(21)23(19)3/h5-12H,4,21H2,1-3H3.
What are the key properties of 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine?
6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine has a molecular weight of 303.41 g/mol, XLogP of 4.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-ethylphenyl)-1,5-dimethylpyrrolo[2,3-f]indol-2-amine is sourced from PubChem (CID 118656020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).