About 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide
2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide (PubChem CID 118656043) has the molecular formula C16H23ClFN7O2
and a molecular weight of 399.86 g/mol. Its IUPAC name is 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide |
| PubChem CID | 118656043 |
| Molecular Formula | C16H23ClFN7O2 |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide |
| SMILES | CC(C)(C)CC(=O)c1cn(CCC(F)Cn2cc(NC(=O)CCl)nn2)nn1 |
| InChI | InChI=1S/C16H23ClFN7O2/c1-16(2,3)6-13(26)12-9-24(22-20-12)5-4-11(18)8-25-10-14(21-23-25)19-15(27)7-17/h9-11H,4-8H2,1-3H3,(H,19,27) |
| InChIKey | JKCLVMIHGCXDDN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide?
The IUPAC name of 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide (CID 118656043) is 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide.
What is the SMILES notation for 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide?
The canonical SMILES for 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide is CC(C)(C)CC(=O)c1cn(CCC(F)Cn2cc(NC(=O)CCl)nn2)nn1.
What is the InChIKey of 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide?
The InChIKey is JKCLVMIHGCXDDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClFN7O2/c1-16(2,3)6-13(26)12-9-24(22-20-12)5-4-11(18)8-25-10-14(21-23-25)19-15(27)7-17/h9-11H,4-8H2,1-3H3,(H,19,27).
What are the key properties of 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide?
2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide has a molecular weight of 399.86 g/mol, XLogP of 2.09, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[1-[4-[4-(3,3-dimethylbutanoyl)triazol-1-yl]-2-fluorobutyl]triazol-4-yl]acetamide is sourced from PubChem (CID 118656043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).