C26H21F5N2O5 — CID 118656558
(2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 118656558) has the molecular formula C26H21F5N2O5 and a molecular weight of 536.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 118656558 |
| Molecular Formula | C26H21F5N2O5 |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | (2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H21F5N2O5/c27-20-16(21(28)23(30)24(31)22(20)29)12-19(35)32-17(10-14-6-8-15(34)9-7-14)25(36)33-18(26(37)38)11-13-4-2-1-3-5-13/h1-9,17-18,34H,10-12H2,(H,32,35)(H,33,36)(H,37,38)/t17-,18-/m0/s1 |
| InChIKey | ZPXHSYZXEIGVNZ-ROUUACIJSA-N |
| XLogP | 3.17 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|