About 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol
1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol (PubChem CID 118656623) has the molecular formula C14H20F2N2O
and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol.
Molecular Properties
| Compound Name | 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol |
| PubChem CID | 118656623 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol |
| SMILES | CCN1CCN(c2c(F)cc(C(C)O)cc2F)CC1 |
| InChI | InChI=1S/C14H20F2N2O/c1-3-17-4-6-18(7-5-17)14-12(15)8-11(10(2)19)9-13(14)16/h8-10,19H,3-7H2,1-2H3 |
| InChIKey | OMAMCQBHLBUCDV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol?
The IUPAC name of 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol (CID 118656623) is 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol.
What is the SMILES notation for 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol?
The canonical SMILES for 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol is CCN1CCN(c2c(F)cc(C(C)O)cc2F)CC1.
What is the InChIKey of 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol?
The InChIKey is OMAMCQBHLBUCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O/c1-3-17-4-6-18(7-5-17)14-12(15)8-11(10(2)19)9-13(14)16/h8-10,19H,3-7H2,1-2H3.
What are the key properties of 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol?
1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol has a molecular weight of 270.32 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-ethylpiperazin-1-yl)-3,5-difluorophenyl]ethanol is sourced from PubChem (CID 118656623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).