C30H38O2S — CID 118656628
5,7-bis[2,6-di(propan-2-yl)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 118656628) has the molecular formula C30H38O2S and a molecular weight of 462.70 g/mol. Its IUPAC name is 5,7-bis[2,6-di(propan-2-yl)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-bis[2,6-di(propan-2-yl)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 118656628 |
| Molecular Formula | C30H38O2S |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 5,7-bis[2,6-di(propan-2-yl)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1sc(-c2c(C(C)C)cccc2C(C)C)c2c1OCCO2 |
| InChI | InChI=1S/C30H38O2S/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-27-28(32-16-15-31-27)30(33-29)26-23(19(5)6)13-10-14-24(26)20(7)8/h9-14,17-20H,15-16H2,1-8H3 |
| InChIKey | MHSZZKSUXVQLKO-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |