C9H11FN2 — CID 118656976
(3E,5E)-5-amino-3-fluoro-4-methylocta-3,5,7-trienenitrile (PubChem CID 118656976) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is (3E,5E)-5-amino-3-fluoro-4-methylocta-3,5,7-trienenitrile.
| Compound Name | (3E,5E)-5-amino-3-fluoro-4-methylocta-3,5,7-trienenitrile |
|---|---|
| PubChem CID | 118656976 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | (3E,5E)-5-amino-3-fluoro-4-methylocta-3,5,7-trienenitrile |
| SMILES | C=C/C=C(N)\C(C)=C(\F)CC#N |
| InChI | InChI=1S/C9H11FN2/c1-3-4-9(12)7(2)8(10)5-6-11/h3-4H,1,5,12H2,2H3/b8-7+,9-4+ |
| InChIKey | YHVUJAHDWCVKSL-UQZXCRFKSA-N |
| XLogP | 2.17 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|